C26H26FN7O — CID 175718321
10-(2-fluoro-4-piperazin-1-ylphenyl)-7-(2-methoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-imine (PubChem CID 175718321) has the molecular formula C26H26FN7O and a molecular weight of 471.54 g/mol. Its IUPAC name is 10-(2-fluoro-4-piperazin-1-ylphenyl)-7-(2-methoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-imine.
| Compound Name | 10-(2-fluoro-4-piperazin-1-ylphenyl)-7-(2-methoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-imine |
|---|---|
| PubChem CID | 175718321 |
| Molecular Formula | C26H26FN7O |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 10-(2-fluoro-4-piperazin-1-ylphenyl)-7-(2-methoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-imine |
| SMILES | [H]/N=c1/nc(-c2ccc(N3CCNCC3)cc2F)c2cc(-c3ccccc3OC)c3n(c-2n1)CCN3 |
| InChI | InChI=1S/C26H26FN7O/c1-35-22-5-3-2-4-17(22)19-15-20-23(31-26(28)32-25(20)34-13-10-30-24(19)34)18-7-6-16(14-21(18)27)33-11-8-29-9-12-33/h2-7,14-15,28-30H,8-13H2,1H3/b28-26- |
| InChIKey | PJMSIHDOHYQPAA-SGEDCAFJSA-N |
| XLogP | 3.18 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |