C24H38O3 — CID 175720812
3-oxo-2,2-bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)butanoic acid (PubChem CID 175720812) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is 3-oxo-2,2-bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)butanoic acid.
| Compound Name | 3-oxo-2,2-bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)butanoic acid |
|---|---|
| PubChem CID | 175720812 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | 3-oxo-2,2-bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)butanoic acid |
| SMILES | CC(=O)C(C(=O)O)(C1CC2CCC1(C)C2(C)C)C1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C24H38O3/c1-14(25)24(19(26)27,17-12-15-8-10-22(17,6)20(15,2)3)18-13-16-9-11-23(18,7)21(16,4)5/h15-18H,8-13H2,1-7H3,(H,26,27) |
| InChIKey | PKCJRXJKIMPACP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|