C20H28O3 — CID 118599659
2-phenoxy-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)butanoic acid (PubChem CID 118599659) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 2-phenoxy-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)butanoic acid.
| Compound Name | 2-phenoxy-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)butanoic acid |
|---|---|
| PubChem CID | 118599659 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 2-phenoxy-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)butanoic acid |
| SMILES | CCC(Oc1ccccc1)(C(=O)O)C1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C20H28O3/c1-5-20(17(21)22,23-15-9-7-6-8-10-15)16-13-14-11-12-19(16,4)18(14,2)3/h6-10,14,16H,5,11-13H2,1-4H3,(H,21,22) |
| InChIKey | ABKXCKYRHADONJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |