C20H27NO3 — CID 70289535
2-cyclohexyl-6-(ethylamino)-2-phenoxyhex-4-ynoic acid (PubChem CID 70289535) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-cyclohexyl-6-(ethylamino)-2-phenoxyhex-4-ynoic acid.
| Compound Name | 2-cyclohexyl-6-(ethylamino)-2-phenoxyhex-4-ynoic acid |
|---|---|
| PubChem CID | 70289535 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 2-cyclohexyl-6-(ethylamino)-2-phenoxyhex-4-ynoic acid |
| SMILES | CCNCC#CCC(Oc1ccccc1)(C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C20H27NO3/c1-2-21-16-10-9-15-20(19(22)23,17-11-5-3-6-12-17)24-18-13-7-4-8-14-18/h4,7-8,13-14,17,21H,2-3,5-6,11-12,15-16H2,1H3,(H,22,23) |
| InChIKey | PJNCDYMWRXFAMC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|