C23H14N4 — CID 175723267
2-(1H-benzimidazol-2-yl)benzo[b][1,10]phenanthroline (PubChem CID 175723267) has the molecular formula C23H14N4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)benzo[b][1,10]phenanthroline.
| Compound Name | 2-(1H-benzimidazol-2-yl)benzo[b][1,10]phenanthroline |
|---|---|
| PubChem CID | 175723267 |
| Molecular Formula | C23H14N4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)benzo[b][1,10]phenanthroline |
| SMILES | c1ccc2nc3c(ccc4ccc(-c5nc6ccccc6[nH]5)nc43)cc2c1 |
| InChI | InChI=1S/C23H14N4/c1-2-6-17-15(5-1)13-16-10-9-14-11-12-20(25-21(14)22(16)24-17)23-26-18-7-3-4-8-19(18)27-23/h1-13H,(H,26,27) |
| InChIKey | KVTWXRBOMAHGKM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|