C28H26N4O — CID 136672980
2-[[2-(1H-benzimidazol-2-yl)quinolin-8-yl]iminomethyl]-4-tert-butyl-6-methylphenol (PubChem CID 136672980) has the molecular formula C28H26N4O and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[[2-(1H-benzimidazol-2-yl)quinolin-8-yl]iminomethyl]-4-tert-butyl-6-methylphenol.
| Compound Name | 2-[[2-(1H-benzimidazol-2-yl)quinolin-8-yl]iminomethyl]-4-tert-butyl-6-methylphenol |
|---|---|
| PubChem CID | 136672980 |
| Molecular Formula | C28H26N4O |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-[[2-(1H-benzimidazol-2-yl)quinolin-8-yl]iminomethyl]-4-tert-butyl-6-methylphenol |
| SMILES | Cc1cc(C(C)(C)C)cc(/C=N/c2cccc3ccc(-c4nc5ccccc5[nH]4)nc23)c1O |
| InChI | InChI=1S/C28H26N4O/c1-17-14-20(28(2,3)4)15-19(26(17)33)16-29-23-11-7-8-18-12-13-24(30-25(18)23)27-31-21-9-5-6-10-22(21)32-27/h5-16,33H,1-4H3,(H,31,32)/b29-16+ |
| InChIKey | CGRXSMWDPWOAQJ-MUFRIFMGSA-N |
| XLogP | 6.84 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|