C16H20O5 — CID 175726239
2-[[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-yl]oxy]-2-(2-methoxyphenyl)acetic acid (PubChem CID 175726239) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-[[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-yl]oxy]-2-(2-methoxyphenyl)acetic acid.
| Compound Name | 2-[[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-yl]oxy]-2-(2-methoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 175726239 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-[[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-yl]oxy]-2-(2-methoxyphenyl)acetic acid |
| SMILES | COc1ccccc1C(OC1C[C@H]2COC[C@@H]2C1)C(=O)O |
| InChI | InChI=1S/C16H20O5/c1-19-14-5-3-2-4-13(14)15(16(17)18)21-12-6-10-8-20-9-11(10)7-12/h2-5,10-12,15H,6-9H2,1H3,(H,17,18)/t10-,11-,15?/m0/s1 |
| InChIKey | NXJIIOGTEZBIPX-AKABHXMESA-N |
| XLogP | 2.26 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |