C23H21FN6O2 — CID 175728285
4-[5-fluoro-2-(5,6,7,8-tetrahydro-1,6-naphthyridin-2-ylamino)pyrimidin-4-yl]-1-propan-2-ylindole-2,3-dione (PubChem CID 175728285) has the molecular formula C23H21FN6O2 and a molecular weight of 432.46 g/mol. Its IUPAC name is 4-[5-fluoro-2-(5,6,7,8-tetrahydro-1,6-naphthyridin-2-ylamino)pyrimidin-4-yl]-1-propan-2-ylindole-2,3-dione.
| Compound Name | 4-[5-fluoro-2-(5,6,7,8-tetrahydro-1,6-naphthyridin-2-ylamino)pyrimidin-4-yl]-1-propan-2-ylindole-2,3-dione |
|---|---|
| PubChem CID | 175728285 |
| Molecular Formula | C23H21FN6O2 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 4-[5-fluoro-2-(5,6,7,8-tetrahydro-1,6-naphthyridin-2-ylamino)pyrimidin-4-yl]-1-propan-2-ylindole-2,3-dione |
| SMILES | CC(C)N1C(=O)C(=O)c2c(-c3nc(Nc4ccc5c(n4)CCNC5)ncc3F)cccc21 |
| InChI | InChI=1S/C23H21FN6O2/c1-12(2)30-17-5-3-4-14(19(17)21(31)22(30)32)20-15(24)11-26-23(29-20)28-18-7-6-13-10-25-9-8-16(13)27-18/h3-7,11-12,25H,8-10H2,1-2H3,(H,26,27,28,29) |
| InChIKey | YFIWYQSGPKOQDN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|