C16H14N8 — CID 175731684
2-[(4-phenylphenyl)methyl]-5-(2H-tetrazol-5-ylmethyl)tetrazole (PubChem CID 175731684) has the molecular formula C16H14N8 and a molecular weight of 318.34 g/mol. Its IUPAC name is 2-[(4-phenylphenyl)methyl]-5-(2H-tetrazol-5-ylmethyl)tetrazole.
| Compound Name | 2-[(4-phenylphenyl)methyl]-5-(2H-tetrazol-5-ylmethyl)tetrazole |
|---|---|
| PubChem CID | 175731684 |
| Molecular Formula | C16H14N8 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 2-[(4-phenylphenyl)methyl]-5-(2H-tetrazol-5-ylmethyl)tetrazole |
| SMILES | c1ccc(-c2ccc(Cn3nnc(Cc4nn[nH]n4)n3)cc2)cc1 |
| InChI | InChI=1S/C16H14N8/c1-2-4-13(5-3-1)14-8-6-12(7-9-14)11-24-20-16(19-23-24)10-15-17-21-22-18-15/h1-9H,10-11H2,(H,17,18,21,22) |
| InChIKey | DNJBUPNJPJMXMY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |