About (4-bromophenyl)sulfonyl (Z)-octadec-9-enoate
(4-bromophenyl)sulfonyl (Z)-octadec-9-enoate (PubChem CID 175741712) has the molecular formula C24H37BrO4S
and a molecular weight of 501.53 g/mol. Its IUPAC name is (4-bromophenyl)sulfonyl (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | (4-bromophenyl)sulfonyl (Z)-octadec-9-enoate |
| PubChem CID | 175741712 |
| Molecular Formula | C24H37BrO4S |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | (4-bromophenyl)sulfonyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H37BrO4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-24(26)29-30(27,28)23-20-18-22(25)19-21-23/h9-10,18-21H,2-8,11-17H2,1H3/b10-9- |
| InChIKey | MCANIOPCZJPXDX-KTKRTIGZSA-N |
| XLogP | 7.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl)sulfonyl (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)sulfonyl (Z)-octadec-9-enoate?
The IUPAC name of (4-bromophenyl)sulfonyl (Z)-octadec-9-enoate (CID 175741712) is (4-bromophenyl)sulfonyl (Z)-octadec-9-enoate.
What is the SMILES notation for (4-bromophenyl)sulfonyl (Z)-octadec-9-enoate?
The canonical SMILES for (4-bromophenyl)sulfonyl (Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)OS(=O)(=O)c1ccc(Br)cc1.
What is the InChIKey of (4-bromophenyl)sulfonyl (Z)-octadec-9-enoate?
The InChIKey is MCANIOPCZJPXDX-KTKRTIGZSA-N. The full InChI is InChI=1S/C24H37BrO4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-24(26)29-30(27,28)23-20-18-22(25)19-21-23/h9-10,18-21H,2-8,11-17H2,1H3/b10-9-.
What are the key properties of (4-bromophenyl)sulfonyl (Z)-octadec-9-enoate?
(4-bromophenyl)sulfonyl (Z)-octadec-9-enoate has a molecular weight of 501.53 g/mol, XLogP of 7.72, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)sulfonyl (Z)-octadec-9-enoate is sourced from PubChem (CID 175741712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).