C20H23NO — CID 175741728
5-[(4-methoxyphenyl)methyl]-3-phenylcyclohex-3-en-1-amine (PubChem CID 175741728) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methyl]-3-phenylcyclohex-3-en-1-amine.
| Compound Name | 5-[(4-methoxyphenyl)methyl]-3-phenylcyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 175741728 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 5-[(4-methoxyphenyl)methyl]-3-phenylcyclohex-3-en-1-amine |
| SMILES | COc1ccc(CC2C=C(c3ccccc3)CC(N)C2)cc1 |
| InChI | InChI=1S/C20H23NO/c1-22-20-9-7-15(8-10-20)11-16-12-18(14-19(21)13-16)17-5-3-2-4-6-17/h2-10,12,16,19H,11,13-14,21H2,1H3 |
| InChIKey | YZBJNYOHNCXKSQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |