C16H30N2O4 — CID 175741897
(1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid (PubChem CID 175741897) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is (1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid.
| Compound Name | (1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid |
|---|---|
| PubChem CID | 175741897 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid |
| SMILES | CC1(NC(=O)O)CCCCC1.CC1(OC(N)=O)CCCCC1 |
| InChI | InChI=1S/2C8H15NO2/c1-8(11-7(9)10)5-3-2-4-6-8;1-8(9-7(10)11)5-3-2-4-6-8/h2-6H2,1H3,(H2,9,10);9H,2-6H2,1H3,(H,10,11) |
| InChIKey | YVAKMFJTLOSDNO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |