(1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid

C16H30N2O4 — CID 175741897

IUPAC(1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid
SMILESCC1(NC(=O)O)CCCCC1.CC1(OC(N)=O)CCCCC1
InChIInChI=1S/2C8H15NO2/c1-8(11-7(9)10)5-3-2-4-6-8;1-8(9-7(10)11)5-3-2-4-6-8/h2-6H2,1H3,(H2,9,10);9H,2-6H2,1H3,(H,10,11)
InChIKeyYVAKMFJTLOSDNO-UHFFFAOYSA-N
MW314.43 g/mol
LogP3.78
Rot. Bonds2

About (1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid

(1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid (PubChem CID 175741897) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is (1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid.

Molecular Properties

Compound Name(1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid
PubChem CID175741897
Molecular FormulaC16H30N2O4
Molecular Weight314.43 g/mol
Exact Mass314.22
IUPAC Name(1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid
SMILESCC1(NC(=O)O)CCCCC1.CC1(OC(N)=O)CCCCC1
InChIInChI=1S/2C8H15NO2/c1-8(11-7(9)10)5-3-2-4-6-8;1-8(9-7(10)11)5-3-2-4-6-8/h2-6H2,1H3,(H2,9,10);9H,2-6H2,1H3,(H,10,11)
InChIKeyYVAKMFJTLOSDNO-UHFFFAOYSA-N
XLogP3.78
TPSA101.65 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.43
LogP ≤ 53.78
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid?
The IUPAC name of (1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid (CID 175741897) is (1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid.
What is the SMILES notation for (1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid?
The canonical SMILES for (1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid is CC1(NC(=O)O)CCCCC1.CC1(OC(N)=O)CCCCC1.
What is the InChIKey of (1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid?
The InChIKey is YVAKMFJTLOSDNO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H15NO2/c1-8(11-7(9)10)5-3-2-4-6-8;1-8(9-7(10)11)5-3-2-4-6-8/h2-6H2,1H3,(H2,9,10);9H,2-6H2,1H3,(H,10,11).
What are the key properties of (1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid?
(1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid has a molecular weight of 314.43 g/mol, XLogP of 3.78, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclohexyl) carbamate;(1-methylcyclohexyl)carbamic acid is sourced from PubChem (CID 175741897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).