C18H25ClN4O — CID 175745176
1-methyl-4-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)indazole-3-carboxamide;hydrochloride (PubChem CID 175745176) has the molecular formula C18H25ClN4O and a molecular weight of 348.88 g/mol. Its IUPAC name is 1-methyl-4-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)indazole-3-carboxamide;hydrochloride.
| Compound Name | 1-methyl-4-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)indazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 175745176 |
| Molecular Formula | C18H25ClN4O |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1-methyl-4-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)indazole-3-carboxamide;hydrochloride |
| SMILES | CN1C2CCCC1CC(c1cccc3c1c(C(N)=O)nn3C)C2.Cl |
| InChI | InChI=1S/C18H24N4O.ClH/c1-21-12-5-3-6-13(21)10-11(9-12)14-7-4-8-15-16(14)17(18(19)23)20-22(15)2;/h4,7-8,11-13H,3,5-6,9-10H2,1-2H3,(H2,19,23);1H |
| InChIKey | NHDUYQKOQCNAQX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |