C17H14N6O2 — CID 175747614
1-[(4-nitrophenyl)methyl]-3-(2H-tetrazol-5-yl)-2H-quinoline (PubChem CID 175747614) has the molecular formula C17H14N6O2 and a molecular weight of 334.34 g/mol. Its IUPAC name is 1-[(4-nitrophenyl)methyl]-3-(2H-tetrazol-5-yl)-2H-quinoline.
| Compound Name | 1-[(4-nitrophenyl)methyl]-3-(2H-tetrazol-5-yl)-2H-quinoline |
|---|---|
| PubChem CID | 175747614 |
| Molecular Formula | C17H14N6O2 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 1-[(4-nitrophenyl)methyl]-3-(2H-tetrazol-5-yl)-2H-quinoline |
| SMILES | O=[N+]([O-])c1ccc(CN2CC(c3nn[nH]n3)=Cc3ccccc32)cc1 |
| InChI | InChI=1S/C17H14N6O2/c24-23(25)15-7-5-12(6-8-15)10-22-11-14(17-18-20-21-19-17)9-13-3-1-2-4-16(13)22/h1-9H,10-11H2,(H,18,19,20,21) |
| InChIKey | CVVVZGSOLUWQNL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|