C13H14N6O2 — CID 82365231
1-[(4-nitrophenyl)methyl]-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine (PubChem CID 82365231) has the molecular formula C13H14N6O2 and a molecular weight of 286.30 g/mol. Its IUPAC name is 1-[(4-nitrophenyl)methyl]-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[(4-nitrophenyl)methyl]-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 82365231 |
| Molecular Formula | C13H14N6O2 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-[(4-nitrophenyl)methyl]-5-(2H-tetrazol-5-yl)-3,6-dihydro-2H-pyridine |
| SMILES | O=[N+]([O-])c1ccc(CN2CCC=C(c3nn[nH]n3)C2)cc1 |
| InChI | InChI=1S/C13H14N6O2/c20-19(21)12-5-3-10(4-6-12)8-18-7-1-2-11(9-18)13-14-16-17-15-13/h2-6H,1,7-9H2,(H,14,15,16,17) |
| InChIKey | GRTUQKFRBCQRSW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|