C19H18F3N3O3S — CID 175748530
N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-sulfamoyl-4-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 175748530) has the molecular formula C19H18F3N3O3S and a molecular weight of 425.43 g/mol. Its IUPAC name is N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-sulfamoyl-4-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-sulfamoyl-4-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175748530 |
| Molecular Formula | C19H18F3N3O3S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-sulfamoyl-4-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | NS(=O)(=O)c1nccc(C(F)(F)F)c1C(=O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C19H18F3N3O3S/c20-19(21,22)14-7-8-24-18(29(23,27)28)15(14)17(26)25-16-12-5-1-3-10(12)9-11-4-2-6-13(11)16/h7-9H,1-6H2,(H,25,26)(H2,23,27,28) |
| InChIKey | JFFLUPHMEYACIJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |