C14H17N5O3 — CID 175750684
tert-butyl N-(1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-10-carbonyl)carbamate (PubChem CID 175750684) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is tert-butyl N-(1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-10-carbonyl)carbamate.
| Compound Name | tert-butyl N-(1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-10-carbonyl)carbamate |
|---|---|
| PubChem CID | 175750684 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | tert-butyl N-(1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-10-carbonyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=O)c1cnn2c3c(cnc12)CCN3 |
| InChI | InChI=1S/C14H17N5O3/c1-14(2,3)22-13(21)18-12(20)9-7-17-19-10-8(4-5-15-10)6-16-11(9)19/h6-7,15H,4-5H2,1-3H3,(H,18,20,21) |
| InChIKey | TXLBTVRZVUXHNA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |