C16H23NNa2O6 — CID 175751518
disodium;(2S)-2-aminopentanedioate;5-pentylbenzene-1,3-diol (PubChem CID 175751518) has the molecular formula C16H23NNa2O6 and a molecular weight of 371.34 g/mol. Its IUPAC name is disodium;(2S)-2-aminopentanedioate;5-pentylbenzene-1,3-diol.
| Compound Name | disodium;(2S)-2-aminopentanedioate;5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 175751518 |
| Molecular Formula | C16H23NNa2O6 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | disodium;(2S)-2-aminopentanedioate;5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)cc(O)c1.N[C@@H](CCC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C11H16O2.C5H9NO4.2Na/c1-2-3-4-5-9-6-10(12)8-11(13)7-9;6-3(5(9)10)1-2-4(7)8;;/h6-8,12-13H,2-5H2,1H3;3H,1-2,6H2,(H,7,8)(H,9,10);;/q;;2*+1/p-2/t;3-;;/m.0../s1 |
| InChIKey | CBSDQOWCXUXKLH-ZRVYWVIDSA-L |
| XLogP | -6.57 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | -6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|