C26H43NO2 — CID 175755885
(Z,2S,12R)-2-benzyl-12-hydroxy-2-methyloctadec-9-enamide (PubChem CID 175755885) has the molecular formula C26H43NO2 and a molecular weight of 401.64 g/mol. Its IUPAC name is (Z,2S,12R)-2-benzyl-12-hydroxy-2-methyloctadec-9-enamide.
| Compound Name | (Z,2S,12R)-2-benzyl-12-hydroxy-2-methyloctadec-9-enamide |
|---|---|
| PubChem CID | 175755885 |
| Molecular Formula | C26H43NO2 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.33 |
| IUPAC Name | (Z,2S,12R)-2-benzyl-12-hydroxy-2-methyloctadec-9-enamide |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCC[C@@](C)(Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C26H43NO2/c1-3-4-5-14-19-24(28)20-15-9-7-6-8-10-16-21-26(2,25(27)29)22-23-17-12-11-13-18-23/h9,11-13,15,17-18,24,28H,3-8,10,14,16,19-22H2,1-2H3,(H2,27,29)/b15-9-/t24-,26+/m1/s1 |
| InChIKey | TZJNFJGBOAFRBL-QAFTXCKVSA-N |
| XLogP | 6.34 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|