C14H14N4O4S3 — CID 175756862
2,4-dioxo-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-1H-thieno[2,3-d]pyrimidine-6-sulfonamide (PubChem CID 175756862) has the molecular formula C14H14N4O4S3 and a molecular weight of 398.49 g/mol. Its IUPAC name is 2,4-dioxo-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-1H-thieno[2,3-d]pyrimidine-6-sulfonamide.
| Compound Name | 2,4-dioxo-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-1H-thieno[2,3-d]pyrimidine-6-sulfonamide |
|---|---|
| PubChem CID | 175756862 |
| Molecular Formula | C14H14N4O4S3 |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 2,4-dioxo-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-1H-thieno[2,3-d]pyrimidine-6-sulfonamide |
| SMILES | NS(=O)(=O)c1cc2c(=O)n(Cc3nc4c(s3)CCCC4)c(=O)[nH]c2s1 |
| InChI | InChI=1S/C14H14N4O4S3/c15-25(21,22)11-5-7-12(24-11)17-14(20)18(13(7)19)6-10-16-8-3-1-2-4-9(8)23-10/h5H,1-4,6H2,(H,17,20)(H2,15,21,22) |
| InChIKey | PAVGIPIJUGLLIV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |