C23H29ClF4N6O4S — CID 175757496
tert-butyl-[[(3S)-1-[2-[[6-(2-chloro-3-fluoro-5-methoxy-4-pyridinyl)-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]ethoxy]-6,6,6-trifluorohexan-3-yl]amino]-oxidosulfanium (PubChem CID 175757496) has the molecular formula C23H29ClF4N6O4S and a molecular weight of 597.04 g/mol. Its IUPAC name is tert-butyl-[[(3S)-1-[2-[[6-(2-chloro-3-fluoro-5-methoxy-4-pyridinyl)-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]ethoxy]-6,6,6-trifluorohexan-3-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(3S)-1-[2-[[6-(2-chloro-3-fluoro-5-methoxy-4-pyridinyl)-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]ethoxy]-6,6,6-trifluorohexan-3-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175757496 |
| Molecular Formula | C23H29ClF4N6O4S |
| Molecular Weight | 597.04 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | tert-butyl-[[(3S)-1-[2-[[6-(2-chloro-3-fluoro-5-methoxy-4-pyridinyl)-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]ethoxy]-6,6,6-trifluorohexan-3-yl]amino]-oxidosulfanium |
| SMILES | COc1cnc(Cl)c(F)c1-c1cn2ncnc2c(OCCOCC[C@H](CCC(F)(F)F)N[S+]([O-])C(C)(C)C)n1 |
| InChI | InChI=1S/C23H29ClF4N6O4S/c1-22(2,3)39(35)33-14(5-7-23(26,27)28)6-8-37-9-10-38-21-20-30-13-31-34(20)12-15(32-21)17-16(36-4)11-29-19(24)18(17)25/h11-14,33H,5-10H2,1-4H3/t14-,39?/m0/s1 |
| InChIKey | FPWJHKFVPFBASQ-XZCJAVLOSA-N |
| XLogP | 4.54 |
| TPSA | 118.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.04 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|