C8H11NO2Se — CID 175759648
(2S)-2-amino-3-(2H-selenopyran-2-yl)propanoic acid (PubChem CID 175759648) has the molecular formula C8H11NO2Se and a molecular weight of 232.14 g/mol. Its IUPAC name is (2S)-2-amino-3-(2H-selenopyran-2-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(2H-selenopyran-2-yl)propanoic acid |
|---|---|
| PubChem CID | 175759648 |
| Molecular Formula | C8H11NO2Se |
| Molecular Weight | 232.14 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | (2S)-2-amino-3-(2H-selenopyran-2-yl)propanoic acid |
| SMILES | N[C@@H](CC1C=CC=C[Se]1)C(=O)O |
| InChI | InChI=1S/C8H11NO2Se/c9-7(8(10)11)5-6-3-1-2-4-12-6/h1-4,6-7H,5,9H2,(H,10,11)/t6?,7-/m0/s1 |
| InChIKey | GXIMLFVUZHSQAY-MLWJPKLSSA-N |
| XLogP | 0.36 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.14 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|