C9H13NO4 — CID 70071102
2-amino-3-(4,4-dihydroxycyclohexa-2,5-dien-1-yl)propanoic acid (PubChem CID 70071102) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-amino-3-(4,4-dihydroxycyclohexa-2,5-dien-1-yl)propanoic acid.
| Compound Name | 2-amino-3-(4,4-dihydroxycyclohexa-2,5-dien-1-yl)propanoic acid |
|---|---|
| PubChem CID | 70071102 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-amino-3-(4,4-dihydroxycyclohexa-2,5-dien-1-yl)propanoic acid |
| SMILES | NC(CC1C=CC(O)(O)C=C1)C(=O)O |
| InChI | InChI=1S/C9H13NO4/c10-7(8(11)12)5-6-1-3-9(13,14)4-2-6/h1-4,6-7,13-14H,5,10H2,(H,11,12) |
| InChIKey | FLEVVTSQGXRZIA-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|