C21H24O6 — CID 175762346
methyl 4-hydroxy-2-(2-methoxy-5-methylphenyl)-4-(2-methoxyphenyl)oxolane-2-carboxylate (PubChem CID 175762346) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is methyl 4-hydroxy-2-(2-methoxy-5-methylphenyl)-4-(2-methoxyphenyl)oxolane-2-carboxylate.
| Compound Name | methyl 4-hydroxy-2-(2-methoxy-5-methylphenyl)-4-(2-methoxyphenyl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 175762346 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | methyl 4-hydroxy-2-(2-methoxy-5-methylphenyl)-4-(2-methoxyphenyl)oxolane-2-carboxylate |
| SMILES | COC(=O)C1(c2cc(C)ccc2OC)CC(O)(c2ccccc2OC)CO1 |
| InChI | InChI=1S/C21H24O6/c1-14-9-10-18(25-3)16(11-14)21(19(22)26-4)12-20(23,13-27-21)15-7-5-6-8-17(15)24-2/h5-11,23H,12-13H2,1-4H3 |
| InChIKey | GUSHANAQDQKANJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |