C28H25ClN2O5S — CID 175762350
3-(2-chloroquinolin-5-yl)sulfonyl-2-(2-methoxy-5-methylphenyl)-4-phenyloxolane-2-carboxamide (PubChem CID 175762350) has the molecular formula C28H25ClN2O5S and a molecular weight of 537.04 g/mol. Its IUPAC name is 3-(2-chloroquinolin-5-yl)sulfonyl-2-(2-methoxy-5-methylphenyl)-4-phenyloxolane-2-carboxamide.
| Compound Name | 3-(2-chloroquinolin-5-yl)sulfonyl-2-(2-methoxy-5-methylphenyl)-4-phenyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 175762350 |
| Molecular Formula | C28H25ClN2O5S |
| Molecular Weight | 537.04 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | 3-(2-chloroquinolin-5-yl)sulfonyl-2-(2-methoxy-5-methylphenyl)-4-phenyloxolane-2-carboxamide |
| SMILES | COc1ccc(C)cc1C1(C(N)=O)OCC(c2ccccc2)C1S(=O)(=O)c1cccc2nc(Cl)ccc12 |
| InChI | InChI=1S/C28H25ClN2O5S/c1-17-11-13-23(35-2)21(15-17)28(27(30)32)26(20(16-36-28)18-7-4-3-5-8-18)37(33,34)24-10-6-9-22-19(24)12-14-25(29)31-22/h3-15,20,26H,16H2,1-2H3,(H2,30,32) |
| InChIKey | NETKIHKBFLPCSC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.04 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|