About sodium;difluorophosphinate;(isocyanatodisulfanyl)imino-oxomethane
sodium;difluorophosphinate;(isocyanatodisulfanyl)imino-oxomethane (PubChem CID 175765699) has the molecular formula C2F2N2NaO4PS2
and a molecular weight of 272.13 g/mol. Its IUPAC name is sodium;difluorophosphinate;(isocyanatodisulfanyl)imino-oxomethane.
Molecular Properties
| Compound Name | sodium;difluorophosphinate;(isocyanatodisulfanyl)imino-oxomethane |
| PubChem CID | 175765699 |
| Molecular Formula | C2F2N2NaO4PS2 |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.89 |
| IUPAC Name | sodium;difluorophosphinate;(isocyanatodisulfanyl)imino-oxomethane |
| SMILES | O=C=NSSN=C=O.O=P([O-])(F)F.[Na+] |
| InChI | InChI=1S/C2N2O2S2.F2HO2P.Na/c5-1-3-7-8-4-2-6;1-5(2,3)4;/h;(H,3,4);/q;;+1/p-1 |
| InChIKey | MYZFKYBXFWWHAN-UHFFFAOYSA-M |
| XLogP | -1.73 |
| TPSA | 98.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;difluorophosphinate;(isocyanatodisulfanyl)imino-oxomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;difluorophosphinate;(isocyanatodisulfanyl)imino-oxomethane?
The IUPAC name of sodium;difluorophosphinate;(isocyanatodisulfanyl)imino-oxomethane (CID 175765699) is sodium;difluorophosphinate;(isocyanatodisulfanyl)imino-oxomethane.
What is the SMILES notation for sodium;difluorophosphinate;(isocyanatodisulfanyl)imino-oxomethane?
The canonical SMILES for sodium;difluorophosphinate;(isocyanatodisulfanyl)imino-oxomethane is O=C=NSSN=C=O.O=P([O-])(F)F.[Na+].
What is the InChIKey of sodium;difluorophosphinate;(isocyanatodisulfanyl)imino-oxomethane?
The InChIKey is MYZFKYBXFWWHAN-UHFFFAOYSA-M. The full InChI is InChI=1S/C2N2O2S2.F2HO2P.Na/c5-1-3-7-8-4-2-6;1-5(2,3)4;/h;(H,3,4);/q;;+1/p-1.
What are the key properties of sodium;difluorophosphinate;(isocyanatodisulfanyl)imino-oxomethane?
sodium;difluorophosphinate;(isocyanatodisulfanyl)imino-oxomethane has a molecular weight of 272.13 g/mol, XLogP of -1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;difluorophosphinate;(isocyanatodisulfanyl)imino-oxomethane is sourced from PubChem (CID 175765699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).