C13H16N2O3 — CID 175768675
2'-hydroxy-8'-methylspiro[cyclohexane-1,3'-imidazo[1,5-a]pyridine]-1',5'-dione (PubChem CID 175768675) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2'-hydroxy-8'-methylspiro[cyclohexane-1,3'-imidazo[1,5-a]pyridine]-1',5'-dione.
| Compound Name | 2'-hydroxy-8'-methylspiro[cyclohexane-1,3'-imidazo[1,5-a]pyridine]-1',5'-dione |
|---|---|
| PubChem CID | 175768675 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2'-hydroxy-8'-methylspiro[cyclohexane-1,3'-imidazo[1,5-a]pyridine]-1',5'-dione |
| SMILES | Cc1ccc(=O)n2c1C(=O)N(O)C21CCCCC1 |
| InChI | InChI=1S/C13H16N2O3/c1-9-5-6-10(16)14-11(9)12(17)15(18)13(14)7-3-2-4-8-13/h5-6,18H,2-4,7-8H2,1H3 |
| InChIKey | XERFYVWJWNGQLS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|