C9H8N6O — CID 175774539
8-(2-azidoethyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 175774539) has the molecular formula C9H8N6O and a molecular weight of 216.20 g/mol. Its IUPAC name is 8-(2-azidoethyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(2-azidoethyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 175774539 |
| Molecular Formula | C9H8N6O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 8-(2-azidoethyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | [N-]=[N+]=NCCn1c(=O)ccc2cncnc21 |
| InChI | InChI=1S/C9H8N6O/c10-14-13-3-4-15-8(16)2-1-7-5-11-6-12-9(7)15/h1-2,5-6H,3-4H2 |
| InChIKey | YXVQWCSWJPEQDO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 96.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|