About cyclotetradec-2-yne-1,7-dithiol
cyclotetradec-2-yne-1,7-dithiol (PubChem CID 175785441) has the molecular formula C14H24S2
and a molecular weight of 256.48 g/mol. Its IUPAC name is cyclotetradec-2-yne-1,7-dithiol.
Molecular Properties
| Compound Name | cyclotetradec-2-yne-1,7-dithiol |
| PubChem CID | 175785441 |
| Molecular Formula | C14H24S2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | cyclotetradec-2-yne-1,7-dithiol |
| SMILES | SC1C#CCCCC(S)CCCCCCC1 |
| InChI | InChI=1S/C14H24S2/c15-13-9-5-2-1-3-6-10-14(16)12-8-4-7-11-13/h13-16H,1-7,9-11H2 |
| InChIKey | FIKFSZANNCBYSU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclotetradec-2-yne-1,7-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclotetradec-2-yne-1,7-dithiol?
The IUPAC name of cyclotetradec-2-yne-1,7-dithiol (CID 175785441) is cyclotetradec-2-yne-1,7-dithiol.
What is the SMILES notation for cyclotetradec-2-yne-1,7-dithiol?
The canonical SMILES for cyclotetradec-2-yne-1,7-dithiol is SC1C#CCCCC(S)CCCCCCC1.
What is the InChIKey of cyclotetradec-2-yne-1,7-dithiol?
The InChIKey is FIKFSZANNCBYSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24S2/c15-13-9-5-2-1-3-6-10-14(16)12-8-4-7-11-13/h13-16H,1-7,9-11H2.
What are the key properties of cyclotetradec-2-yne-1,7-dithiol?
cyclotetradec-2-yne-1,7-dithiol has a molecular weight of 256.48 g/mol, XLogP of 4.50, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclotetradec-2-yne-1,7-dithiol is sourced from PubChem (CID 175785441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).