C11H16 — CID 123449003
4,5-didehydro-2,3,3a,6,7,8,9,9a-octahydro-1H-cyclopenta[8]annulene (PubChem CID 123449003) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 4,5-didehydro-2,3,3a,6,7,8,9,9a-octahydro-1H-cyclopenta[8]annulene.
| Compound Name | 4,5-didehydro-2,3,3a,6,7,8,9,9a-octahydro-1H-cyclopenta[8]annulene |
|---|---|
| PubChem CID | 123449003 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 4,5-didehydro-2,3,3a,6,7,8,9,9a-octahydro-1H-cyclopenta[8]annulene |
| SMILES | C1#CC2CCCC2CCCC1 |
| InChI | InChI=1S/C11H16/c1-2-4-7-11-9-5-8-10(11)6-3-1/h10-11H,1-3,5-6,8-9H2 |
| InChIKey | DINOGFBEZNCBAA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|