C12H18N2O — CID 175787985
5-[1-(cyclopropylmethyl)piperidin-4-yl]-1,2-oxazole (PubChem CID 175787985) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 5-[1-(cyclopropylmethyl)piperidin-4-yl]-1,2-oxazole.
| Compound Name | 5-[1-(cyclopropylmethyl)piperidin-4-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 175787985 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 5-[1-(cyclopropylmethyl)piperidin-4-yl]-1,2-oxazole |
| SMILES | c1cc(C2CCN(CC3CC3)CC2)on1 |
| InChI | InChI=1S/C12H18N2O/c1-2-10(1)9-14-7-4-11(5-8-14)12-3-6-13-15-12/h3,6,10-11H,1-2,4-5,7-9H2 |
| InChIKey | GQONENZFVYRIQF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |