C23H22N4O3 — CID 175788089
2-[2-[2-[[3-(2-oxo-1,3-dihydroindol-5-yl)-2-pyridinyl]amino]ethoxy]phenyl]acetamide (PubChem CID 175788089) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-[2-[2-[[3-(2-oxo-1,3-dihydroindol-5-yl)-2-pyridinyl]amino]ethoxy]phenyl]acetamide.
| Compound Name | 2-[2-[2-[[3-(2-oxo-1,3-dihydroindol-5-yl)-2-pyridinyl]amino]ethoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 175788089 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-[2-[2-[[3-(2-oxo-1,3-dihydroindol-5-yl)-2-pyridinyl]amino]ethoxy]phenyl]acetamide |
| SMILES | NC(=O)Cc1ccccc1OCCNc1ncccc1-c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C23H22N4O3/c24-21(28)13-16-4-1-2-6-20(16)30-11-10-26-23-18(5-3-9-25-23)15-7-8-19-17(12-15)14-22(29)27-19/h1-9,12H,10-11,13-14H2,(H2,24,28)(H,25,26)(H,27,29) |
| InChIKey | JZFSLCFYGHFRKG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|