C15H14F3NO4S — CID 175788644
(2-methylthiophen-3-yl) carbamate;2-methyl-5-(trifluoromethyl)benzoic acid (PubChem CID 175788644) has the molecular formula C15H14F3NO4S and a molecular weight of 361.34 g/mol. Its IUPAC name is (2-methylthiophen-3-yl) carbamate;2-methyl-5-(trifluoromethyl)benzoic acid.
| Compound Name | (2-methylthiophen-3-yl) carbamate;2-methyl-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 175788644 |
| Molecular Formula | C15H14F3NO4S |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | (2-methylthiophen-3-yl) carbamate;2-methyl-5-(trifluoromethyl)benzoic acid |
| SMILES | Cc1ccc(C(F)(F)F)cc1C(=O)O.Cc1sccc1OC(N)=O |
| InChI | InChI=1S/C9H7F3O2.C6H7NO2S/c1-5-2-3-6(9(10,11)12)4-7(5)8(13)14;1-4-5(2-3-10-4)9-6(7)8/h2-4H,1H3,(H,13,14);2-3H,1H3,(H2,7,8) |
| InChIKey | ABNNEJCEEUYQER-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |