About (2-methylthiophen-3-yl) carbamate
(2-methylthiophen-3-yl) carbamate (PubChem CID 175339056) has the molecular formula C6H7NO2S
and a molecular weight of 157.19 g/mol. Its IUPAC name is (2-methylthiophen-3-yl) carbamate.
Molecular Properties
| Compound Name | (2-methylthiophen-3-yl) carbamate |
| PubChem CID | 175339056 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | (2-methylthiophen-3-yl) carbamate |
| SMILES | Cc1sccc1OC(N)=O |
| InChI | InChI=1S/C6H7NO2S/c1-4-5(2-3-10-4)9-6(7)8/h2-3H,1H3,(H2,7,8) |
| InChIKey | SYUPPAGBYDFEBS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methylthiophen-3-yl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylthiophen-3-yl) carbamate?
The IUPAC name of (2-methylthiophen-3-yl) carbamate (CID 175339056) is (2-methylthiophen-3-yl) carbamate.
What is the SMILES notation for (2-methylthiophen-3-yl) carbamate?
The canonical SMILES for (2-methylthiophen-3-yl) carbamate is Cc1sccc1OC(N)=O.
What is the InChIKey of (2-methylthiophen-3-yl) carbamate?
The InChIKey is SYUPPAGBYDFEBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S/c1-4-5(2-3-10-4)9-6(7)8/h2-3H,1H3,(H2,7,8).
What are the key properties of (2-methylthiophen-3-yl) carbamate?
(2-methylthiophen-3-yl) carbamate has a molecular weight of 157.19 g/mol, XLogP of 1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylthiophen-3-yl) carbamate is sourced from PubChem (CID 175339056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).