C16H10F2N2OS — CID 175797319
8-(2,4-difluorophenyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one (PubChem CID 175797319) has the molecular formula C16H10F2N2OS and a molecular weight of 316.33 g/mol. Its IUPAC name is 8-(2,4-difluorophenyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one.
| Compound Name | 8-(2,4-difluorophenyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
|---|---|
| PubChem CID | 175797319 |
| Molecular Formula | C16H10F2N2OS |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 8-(2,4-difluorophenyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
| SMILES | O=c1ncc2ccc(-c3ccc(F)cc3F)c3c2n1CCS3 |
| InChI | InChI=1S/C16H10F2N2OS/c17-10-2-4-11(13(18)7-10)12-3-1-9-8-19-16(21)20-5-6-22-15(12)14(9)20/h1-4,7-8H,5-6H2 |
| InChIKey | ZZATVJLTPHPFHS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |