C23H22ClF2N5OS — CID 156797435
acetonitrile;7-chloro-8-(2,4-difluorophenyl)-4-(4-methylpiperazin-1-yl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one (PubChem CID 156797435) has the molecular formula C23H22ClF2N5OS and a molecular weight of 489.98 g/mol. Its IUPAC name is acetonitrile;7-chloro-8-(2,4-difluorophenyl)-4-(4-methylpiperazin-1-yl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one.
| Compound Name | acetonitrile;7-chloro-8-(2,4-difluorophenyl)-4-(4-methylpiperazin-1-yl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
|---|---|
| PubChem CID | 156797435 |
| Molecular Formula | C23H22ClF2N5OS |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | acetonitrile;7-chloro-8-(2,4-difluorophenyl)-4-(4-methylpiperazin-1-yl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
| SMILES | CC#N.CN1CCN(c2nc(=O)n3c4c(c(-c5ccc(F)cc5F)c(Cl)cc24)SCC3)CC1 |
| InChI | InChI=1S/C21H19ClF2N4OS.C2H3N/c1-26-4-6-27(7-5-26)20-14-11-15(22)17(13-3-2-12(23)10-16(13)24)19-18(14)28(8-9-30-19)21(29)25-20;1-2-3/h2-3,10-11H,4-9H2,1H3;1H3 |
| InChIKey | WRRPWTBDLFBAJS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |