C25H25ClF2N4O4S2 — CID 156520795
7-chloro-8-(2,4-difluorophenyl)-4-[(3S)-4-(1-hydroxyprop-2-enyl)-3-(methylsulfonylmethyl)piperazin-1-yl]-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one (PubChem CID 156520795) has the molecular formula C25H25ClF2N4O4S2 and a molecular weight of 583.08 g/mol. Its IUPAC name is 7-chloro-8-(2,4-difluorophenyl)-4-[(3S)-4-(1-hydroxyprop-2-enyl)-3-(methylsulfonylmethyl)piperazin-1-yl]-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one.
| Compound Name | 7-chloro-8-(2,4-difluorophenyl)-4-[(3S)-4-(1-hydroxyprop-2-enyl)-3-(methylsulfonylmethyl)piperazin-1-yl]-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
|---|---|
| PubChem CID | 156520795 |
| Molecular Formula | C25H25ClF2N4O4S2 |
| Molecular Weight | 583.08 g/mol |
| Exact Mass | 582.10 |
| IUPAC Name | 7-chloro-8-(2,4-difluorophenyl)-4-[(3S)-4-(1-hydroxyprop-2-enyl)-3-(methylsulfonylmethyl)piperazin-1-yl]-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
| SMILES | C=CC(O)N1CCN(c2nc(=O)n3c4c(c(-c5ccc(F)cc5F)c(Cl)cc24)SCC3)C[C@H]1CS(C)(=O)=O |
| InChI | InChI=1S/C25H25ClF2N4O4S2/c1-3-20(33)31-7-6-30(12-15(31)13-38(2,35)36)24-17-11-18(26)21(16-5-4-14(27)10-19(16)28)23-22(17)32(8-9-37-23)25(34)29-24/h3-5,10-11,15,20,33H,1,6-9,12-13H2,2H3/t15-,20?/m0/s1 |
| InChIKey | HVAWPGPIWRUAJX-OOJLDXBWSA-N |
| XLogP | 3.14 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.08 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|