C28H31ClF2N4O4S — CID 167115416
7-chloro-8-(2,4-difluorophenyl)-4-[(3S,5R)-4-(1-hydroxyprop-2-enyl)-3,5-dimethylpiperazin-1-yl]-12-(methoxymethoxy)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one (PubChem CID 167115416) has the molecular formula C28H31ClF2N4O4S and a molecular weight of 593.10 g/mol. Its IUPAC name is 7-chloro-8-(2,4-difluorophenyl)-4-[(3S,5R)-4-(1-hydroxyprop-2-enyl)-3,5-dimethylpiperazin-1-yl]-12-(methoxymethoxy)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one.
| Compound Name | 7-chloro-8-(2,4-difluorophenyl)-4-[(3S,5R)-4-(1-hydroxyprop-2-enyl)-3,5-dimethylpiperazin-1-yl]-12-(methoxymethoxy)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
|---|---|
| PubChem CID | 167115416 |
| Molecular Formula | C28H31ClF2N4O4S |
| Molecular Weight | 593.10 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | 7-chloro-8-(2,4-difluorophenyl)-4-[(3S,5R)-4-(1-hydroxyprop-2-enyl)-3,5-dimethylpiperazin-1-yl]-12-(methoxymethoxy)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
| SMILES | C=CC(O)N1[C@H](C)CN(c2nc(=O)n3c4c(c(-c5ccc(F)cc5F)c(Cl)cc24)SCC(OCOC)C3)C[C@@H]1C |
| InChI | InChI=1S/C28H31ClF2N4O4S/c1-5-23(36)35-15(2)10-33(11-16(35)3)27-20-9-21(29)24(19-7-6-17(30)8-22(19)31)26-25(20)34(28(37)32-27)12-18(13-40-26)39-14-38-4/h5-9,15-16,18,23,36H,1,10-14H2,2-4H3/t15-,16+,18?,23? |
| InChIKey | FNUXXPJVSSTDBW-BUIXOBLPSA-N |
| XLogP | 4.49 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.10 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|