C24H24ClF2N5O2S — CID 156520528
4-[7-chloro-8-(2,4-difluorophenyl)-2-oxo-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-4-yl]-2-[2-(methylamino)ethyl]piperazine-2-carbaldehyde (PubChem CID 156520528) has the molecular formula C24H24ClF2N5O2S and a molecular weight of 520.01 g/mol. Its IUPAC name is 4-[7-chloro-8-(2,4-difluorophenyl)-2-oxo-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-4-yl]-2-[2-(methylamino)ethyl]piperazine-2-carbaldehyde.
| Compound Name | 4-[7-chloro-8-(2,4-difluorophenyl)-2-oxo-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-4-yl]-2-[2-(methylamino)ethyl]piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 156520528 |
| Molecular Formula | C24H24ClF2N5O2S |
| Molecular Weight | 520.01 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 4-[7-chloro-8-(2,4-difluorophenyl)-2-oxo-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-4-yl]-2-[2-(methylamino)ethyl]piperazine-2-carbaldehyde |
| SMILES | CNCCC1(C=O)CN(c2nc(=O)n3c4c(c(-c5ccc(F)cc5F)c(Cl)cc24)SCC3)CCN1 |
| InChI | InChI=1S/C24H24ClF2N5O2S/c1-28-5-4-24(13-33)12-31(7-6-29-24)22-16-11-17(25)19(15-3-2-14(26)10-18(15)27)21-20(16)32(8-9-35-21)23(34)30-22/h2-3,10-11,13,28-29H,4-9,12H2,1H3 |
| InChIKey | WSQSQIVMGTZMFN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.01 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|