C16H19N5O2 — CID 175800553
4-[(1-prop-2-enoylpyrrolidin-3-yl)methylamino]pyrrolo[1,2-b]pyridazine-3-carboxamide (PubChem CID 175800553) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-[(1-prop-2-enoylpyrrolidin-3-yl)methylamino]pyrrolo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 4-[(1-prop-2-enoylpyrrolidin-3-yl)methylamino]pyrrolo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 175800553 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-[(1-prop-2-enoylpyrrolidin-3-yl)methylamino]pyrrolo[1,2-b]pyridazine-3-carboxamide |
| SMILES | C=CC(=O)N1CCC(CNc2c(C(N)=O)cnn3cccc23)C1 |
| InChI | InChI=1S/C16H19N5O2/c1-2-14(22)20-7-5-11(10-20)8-18-15-12(16(17)23)9-19-21-6-3-4-13(15)21/h2-4,6,9,11,18H,1,5,7-8,10H2,(H2,17,23) |
| InChIKey | CYQFICBIOFZBGV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|