C30H21Br — CID 175805471
1-(2-bromophenyl)-3-deuterio-2,4,5-triphenylbenzene (PubChem CID 175805471) has the molecular formula C30H21Br and a molecular weight of 462.41 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-deuterio-2,4,5-triphenylbenzene.
| Compound Name | 1-(2-bromophenyl)-3-deuterio-2,4,5-triphenylbenzene |
|---|---|
| PubChem CID | 175805471 |
| Molecular Formula | C30H21Br |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 1-(2-bromophenyl)-3-deuterio-2,4,5-triphenylbenzene |
| SMILES | [2H]c1c(-c2ccccc2)c(-c2ccccc2)cc(-c2ccccc2Br)c1-c1ccccc1 |
| InChI | InChI=1S/C30H21Br/c31-30-19-11-10-18-25(30)29-21-27(23-14-6-2-7-15-23)26(22-12-4-1-5-13-22)20-28(29)24-16-8-3-9-17-24/h1-21H/i20D |
| InChIKey | SEFSHCTYHUMJAJ-YVHRXSIGSA-N |
| XLogP | 9.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |