About amino 2-pyrazol-1-ylacetate
amino 2-pyrazol-1-ylacetate (PubChem CID 175809673) has the molecular formula C5H7N3O2
and a molecular weight of 141.13 g/mol. Its IUPAC name is amino 2-pyrazol-1-ylacetate.
Molecular Properties
| Compound Name | amino 2-pyrazol-1-ylacetate |
| PubChem CID | 175809673 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | amino 2-pyrazol-1-ylacetate |
| SMILES | NOC(=O)Cn1cccn1 |
| InChI | InChI=1S/C5H7N3O2/c6-10-5(9)4-8-3-1-2-7-8/h1-3H,4,6H2 |
| InChIKey | IOSJGTLFATWFMR-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 2-pyrazol-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 2-pyrazol-1-ylacetate?
The IUPAC name of amino 2-pyrazol-1-ylacetate (CID 175809673) is amino 2-pyrazol-1-ylacetate.
What is the SMILES notation for amino 2-pyrazol-1-ylacetate?
The canonical SMILES for amino 2-pyrazol-1-ylacetate is NOC(=O)Cn1cccn1.
What is the InChIKey of amino 2-pyrazol-1-ylacetate?
The InChIKey is IOSJGTLFATWFMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2/c6-10-5(9)4-8-3-1-2-7-8/h1-3H,4,6H2.
What are the key properties of amino 2-pyrazol-1-ylacetate?
amino 2-pyrazol-1-ylacetate has a molecular weight of 141.13 g/mol, XLogP of -0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino 2-pyrazol-1-ylacetate is sourced from PubChem (CID 175809673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).