C9H9F3N2O2 — CID 163220388
3,4,4-trifluorobut-3-enyl 2-pyrazol-1-ylacetate (PubChem CID 163220388) has the molecular formula C9H9F3N2O2 and a molecular weight of 234.18 g/mol. Its IUPAC name is 3,4,4-trifluorobut-3-enyl 2-pyrazol-1-ylacetate.
| Compound Name | 3,4,4-trifluorobut-3-enyl 2-pyrazol-1-ylacetate |
|---|---|
| PubChem CID | 163220388 |
| Molecular Formula | C9H9F3N2O2 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 3,4,4-trifluorobut-3-enyl 2-pyrazol-1-ylacetate |
| SMILES | O=C(Cn1cccn1)OCCC(F)=C(F)F |
| InChI | InChI=1S/C9H9F3N2O2/c10-7(9(11)12)2-5-16-8(15)6-14-4-1-3-13-14/h1,3-4H,2,5-6H2 |
| InChIKey | WCSCCDKSJJFTNZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |