About 2-pyrazol-1-ylethyl 3-(4-aminophenoxy)propanoate
2-pyrazol-1-ylethyl 3-(4-aminophenoxy)propanoate (PubChem CID 61495027) has the molecular formula C14H17N3O3
and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-pyrazol-1-ylethyl 3-(4-aminophenoxy)propanoate.
Molecular Properties
| Compound Name | 2-pyrazol-1-ylethyl 3-(4-aminophenoxy)propanoate |
| PubChem CID | 61495027 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-pyrazol-1-ylethyl 3-(4-aminophenoxy)propanoate |
| SMILES | Nc1ccc(OCCC(=O)OCCn2cccn2)cc1 |
| InChI | InChI=1S/C14H17N3O3/c15-12-2-4-13(5-3-12)19-10-6-14(18)20-11-9-17-8-1-7-16-17/h1-5,7-8H,6,9-11,15H2 |
| InChIKey | YDUSBTYZZXHLQE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrazol-1-ylethyl 3-(4-aminophenoxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazol-1-ylethyl 3-(4-aminophenoxy)propanoate?
The IUPAC name of 2-pyrazol-1-ylethyl 3-(4-aminophenoxy)propanoate (CID 61495027) is 2-pyrazol-1-ylethyl 3-(4-aminophenoxy)propanoate.
What is the SMILES notation for 2-pyrazol-1-ylethyl 3-(4-aminophenoxy)propanoate?
The canonical SMILES for 2-pyrazol-1-ylethyl 3-(4-aminophenoxy)propanoate is Nc1ccc(OCCC(=O)OCCn2cccn2)cc1.
What is the InChIKey of 2-pyrazol-1-ylethyl 3-(4-aminophenoxy)propanoate?
The InChIKey is YDUSBTYZZXHLQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3/c15-12-2-4-13(5-3-12)19-10-6-14(18)20-11-9-17-8-1-7-16-17/h1-5,7-8H,6,9-11,15H2.
What are the key properties of 2-pyrazol-1-ylethyl 3-(4-aminophenoxy)propanoate?
2-pyrazol-1-ylethyl 3-(4-aminophenoxy)propanoate has a molecular weight of 275.31 g/mol, XLogP of 1.48, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazol-1-ylethyl 3-(4-aminophenoxy)propanoate is sourced from PubChem (CID 61495027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).