About 2-hydroxyethyl 3-pyrazol-1-ylpropanoate
2-hydroxyethyl 3-pyrazol-1-ylpropanoate (PubChem CID 54088035) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is 2-hydroxyethyl 3-pyrazol-1-ylpropanoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 3-pyrazol-1-ylpropanoate |
| PubChem CID | 54088035 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-hydroxyethyl 3-pyrazol-1-ylpropanoate |
| SMILES | O=C(CCn1cccn1)OCCO |
| InChI | InChI=1S/C8H12N2O3/c11-6-7-13-8(12)2-5-10-4-1-3-9-10/h1,3-4,11H,2,5-7H2 |
| InChIKey | MRWFXYSQSDPKSS-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-hydroxyethyl 3-pyrazol-1-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 3-pyrazol-1-ylpropanoate?
The IUPAC name of 2-hydroxyethyl 3-pyrazol-1-ylpropanoate (CID 54088035) is 2-hydroxyethyl 3-pyrazol-1-ylpropanoate.
What is the SMILES notation for 2-hydroxyethyl 3-pyrazol-1-ylpropanoate?
The canonical SMILES for 2-hydroxyethyl 3-pyrazol-1-ylpropanoate is O=C(CCn1cccn1)OCCO.
What is the InChIKey of 2-hydroxyethyl 3-pyrazol-1-ylpropanoate?
The InChIKey is MRWFXYSQSDPKSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c11-6-7-13-8(12)2-5-10-4-1-3-9-10/h1,3-4,11H,2,5-7H2.
What are the key properties of 2-hydroxyethyl 3-pyrazol-1-ylpropanoate?
2-hydroxyethyl 3-pyrazol-1-ylpropanoate has a molecular weight of 184.19 g/mol, XLogP of -0.19, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 3-pyrazol-1-ylpropanoate is sourced from PubChem (CID 54088035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).