C23H25NO4S — CID 175810915
methyl 3-[(7S,7aS)-1-benzylsulfonyl-2,3,5,6,7,7a-hexahydroindol-7-yl]benzoate (PubChem CID 175810915) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is methyl 3-[(7S,7aS)-1-benzylsulfonyl-2,3,5,6,7,7a-hexahydroindol-7-yl]benzoate.
| Compound Name | methyl 3-[(7S,7aS)-1-benzylsulfonyl-2,3,5,6,7,7a-hexahydroindol-7-yl]benzoate |
|---|---|
| PubChem CID | 175810915 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | methyl 3-[(7S,7aS)-1-benzylsulfonyl-2,3,5,6,7,7a-hexahydroindol-7-yl]benzoate |
| SMILES | COC(=O)c1cccc([C@@H]2CCC=C3CCN(S(=O)(=O)Cc4ccccc4)[C@H]32)c1 |
| InChI | InChI=1S/C23H25NO4S/c1-28-23(25)20-11-5-10-19(15-20)21-12-6-9-18-13-14-24(22(18)21)29(26,27)16-17-7-3-2-4-8-17/h2-5,7-11,15,21-22H,6,12-14,16H2,1H3/t21-,22+/m0/s1 |
| InChIKey | ZKUHERGAFAPMIQ-FCHUYYIVSA-N |
| XLogP | 3.88 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|