C7H15NO3Si — CID 175812612
(2S)-2-(butylidenesilylamino)-3-hydroxypropanoic acid (PubChem CID 175812612) has the molecular formula C7H15NO3Si and a molecular weight of 189.29 g/mol. Its IUPAC name is (2S)-2-(butylidenesilylamino)-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-(butylidenesilylamino)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 175812612 |
| Molecular Formula | C7H15NO3Si |
| Molecular Weight | 189.29 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (2S)-2-(butylidenesilylamino)-3-hydroxypropanoic acid |
| SMILES | CCC/C=[SiH]/N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C7H15NO3Si/c1-2-3-4-12-8-6(5-9)7(10)11/h4,6,8-9,12H,2-3,5H2,1H3,(H,10,11)/b12-4+/t6-/m0/s1 |
| InChIKey | IUEKFSQJIJFVTK-JSTDCQMXSA-N |
| XLogP | -1.02 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.29 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|