C13H18N2O — CID 175818240
1-(3-deuterio-3,4-dihydro-2H-chromen-7-yl)piperazine (PubChem CID 175818240) has the molecular formula C13H18N2O and a molecular weight of 219.31 g/mol. Its IUPAC name is 1-(3-deuterio-3,4-dihydro-2H-chromen-7-yl)piperazine.
| Compound Name | 1-(3-deuterio-3,4-dihydro-2H-chromen-7-yl)piperazine |
|---|---|
| PubChem CID | 175818240 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 1-(3-deuterio-3,4-dihydro-2H-chromen-7-yl)piperazine |
| SMILES | [2H]C1COc2cc(N3CCNCC3)ccc2C1 |
| InChI | InChI=1S/C13H18N2O/c1-2-11-3-4-12(10-13(11)16-9-1)15-7-5-14-6-8-15/h3-4,10,14H,1-2,5-9H2/i1D |
| InChIKey | XMZSYDYAFIJGOA-MICDWDOJSA-N |
| XLogP | 1.42 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |