C26H39F3N4O9 — CID 175818756
N-[2-[2-[2-[2-[[(1S,2R,6R,7R,8S)-4,4-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 175818756) has the molecular formula C26H39F3N4O9 and a molecular weight of 608.61 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[[(1S,2R,6R,7R,8S)-4,4-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | N-[2-[2-[2-[2-[[(1S,2R,6R,7R,8S)-4,4-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 175818756 |
| Molecular Formula | C26H39F3N4O9 |
| Molecular Weight | 608.61 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | N-[2-[2-[2-[2-[[(1S,2R,6R,7R,8S)-4,4-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CCC(=O)NCCOCCOCCOCCOC[C@@]12CO[C@@H](O1)[C@H](Nc1cncc(C(F)(F)F)n1)[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C26H39F3N4O9/c1-4-19(34)31-5-6-35-7-8-36-9-10-37-11-12-38-15-25-16-39-23(42-25)20(21-22(25)41-24(2,3)40-21)33-18-14-30-13-17(32-18)26(27,28)29/h13-14,20-23H,4-12,15-16H2,1-3H3,(H,31,34)(H,32,33)/t20-,21-,22-,23+,25+/m1/s1 |
| InChIKey | WJCSIZBGCOHPIN-LNUJRPSNSA-N |
| XLogP | 1.51 |
| TPSA | 140.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.61 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|