C23H35F3N4O8 — CID 167221978
N-[(1S,2R,6R,7R,8S)-1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]-6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 167221978) has the molecular formula C23H35F3N4O8 and a molecular weight of 552.55 g/mol. Its IUPAC name is N-[(1S,2R,6R,7R,8S)-1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]-6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | N-[(1S,2R,6R,7R,8S)-1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]-6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 167221978 |
| Molecular Formula | C23H35F3N4O8 |
| Molecular Weight | 552.55 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | N-[(1S,2R,6R,7R,8S)-1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]-6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC1(C)O[C@@H]2[C@@H](Nc3cncc(C(F)(F)F)n3)[C@H]3OC[C@](COCCOCCOCCOCCN)(O3)[C@@H]2O1 |
| InChI | InChI=1S/C23H35F3N4O8/c1-21(2)36-18-17(30-16-12-28-11-15(29-16)23(24,25)26)20-35-14-22(38-20,19(18)37-21)13-34-10-9-33-8-7-32-6-5-31-4-3-27/h11-12,17-20H,3-10,13-14,27H2,1-2H3,(H,29,30)/t17-,18-,19-,20+,22+/m1/s1 |
| InChIKey | DSVKQRLTFWLLHW-YHZBMZHBSA-N |
| XLogP | 0.95 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.55 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|